C5H13N2O5P — CID 139078118
azanium hydroxy-[[(5R)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]phosphinate (PubChem CID 139078118) has the molecular formula C5H13N2O5P and a molecular weight of 212.14 g/mol. Its IUPAC name is azanium hydroxy-[[(5R)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]phosphinate.
| Compound Name | azanium hydroxy-[[(5R)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]phosphinate |
|---|---|
| PubChem CID | 139078118 |
| Molecular Formula | C5H13N2O5P |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | azanium hydroxy-[[(5R)-5-methyl-2-oxo-1,3-oxazolidin-3-yl]methyl]phosphinate |
| SMILES | C[C@@H]1CN(CP(=O)([O-])O)C(=O)O1.[NH4+] |
| InChI | InChI=1S/C5H10NO5P.H3N/c1-4-2-6(5(7)11-4)3-12(8,9)10;/h4H,2-3H2,1H3,(H2,8,9,10);1H3/t4-;/m1./s1 |
| InChIKey | XBTNEFZRXAUQDN-PGMHMLKASA-N |
| XLogP | -0.29 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|