C11H19NO3S — CID 59986935
(5S)-5-methyl-3-[5-(methyl-methylidene-oxo-λ6-sulfanyl)pent-3-enyl]-1,3-oxazolidin-2-one (PubChem CID 59986935) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is (5S)-5-methyl-3-[5-(methyl-methylidene-oxo-λ6-sulfanyl)pent-3-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-methyl-3-[5-(methyl-methylidene-oxo-λ6-sulfanyl)pent-3-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59986935 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (5S)-5-methyl-3-[5-(methyl-methylidene-oxo-λ6-sulfanyl)pent-3-enyl]-1,3-oxazolidin-2-one |
| SMILES | C=S(C)(=O)CC=CCCN1C[C@H](C)OC1=O |
| InChI | InChI=1S/C11H19NO3S/c1-10-9-12(11(13)15-10)7-5-4-6-8-16(2,3)14/h4,6,10H,2,5,7-9H2,1,3H3/t10-,16?/m0/s1 |
| InChIKey | JTBOLINLBMLEAJ-VQVVDHBBSA-N |
| XLogP | 1.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|