C10H17NO3S — CID 59986951
(5S)-5-methyl-3-[4-(methyl-methylidene-oxo-λ6-sulfanyl)but-2-enyl]-1,3-oxazolidin-2-one (PubChem CID 59986951) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is (5S)-5-methyl-3-[4-(methyl-methylidene-oxo-λ6-sulfanyl)but-2-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-methyl-3-[4-(methyl-methylidene-oxo-λ6-sulfanyl)but-2-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59986951 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (5S)-5-methyl-3-[4-(methyl-methylidene-oxo-λ6-sulfanyl)but-2-enyl]-1,3-oxazolidin-2-one |
| SMILES | C=S(C)(=O)CC=CCN1C[C@H](C)OC1=O |
| InChI | InChI=1S/C10H17NO3S/c1-9-8-11(10(12)14-9)6-4-5-7-15(2,3)13/h4-5,9H,2,6-8H2,1,3H3/t9-,15?/m0/s1 |
| InChIKey | XMUUNTBOTUWJSV-HJULIUOESA-N |
| XLogP | 0.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|