C8H14N2O2 — CID 172711491
ethenamine;3-ethenyl-5-methyl-1,3-oxazolidin-2-one (PubChem CID 172711491) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is ethenamine;3-ethenyl-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | ethenamine;3-ethenyl-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 172711491 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethenamine;3-ethenyl-5-methyl-1,3-oxazolidin-2-one |
| SMILES | C=CN.C=CN1CC(C)OC1=O |
| InChI | InChI=1S/C6H9NO2.C2H5N/c1-3-7-4-5(2)9-6(7)8;1-2-3/h3,5H,1,4H2,2H3;2H,1,3H2 |
| InChIKey | FHRACKLWYCGAMS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |