C10H11NO3 — CID 105446773
3-(4-hydroxyphenyl)-5-methyl-1,3-oxazolidin-2-one (PubChem CID 105446773) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | 3-(4-hydroxyphenyl)-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 105446773 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3-(4-hydroxyphenyl)-5-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1CN(c2ccc(O)cc2)C(=O)O1 |
| InChI | InChI=1S/C10H11NO3/c1-7-6-11(10(13)14-7)8-2-4-9(12)5-3-8/h2-5,7,12H,6H2,1H3 |
| InChIKey | LGBNDGKYAMGSAO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |