C13H20O3 — CID 59103852
(7aS)-7-ethylidenespiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane] (PubChem CID 59103852) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (7aS)-7-ethylidenespiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane].
| Compound Name | (7aS)-7-ethylidenespiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 59103852 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (7aS)-7-ethylidenespiro[4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane] |
| SMILES | CC=C1COCC2OC3(CCCCC3)O[C@@H]12 |
| InChI | InChI=1S/C13H20O3/c1-2-10-8-14-9-11-12(10)16-13(15-11)6-4-3-5-7-13/h2,11-12H,3-9H2,1H3/t11?,12-/m0/s1 |
| InChIKey | CHPQSUROTHMEMH-KIYNQFGBSA-N |
| XLogP | 2.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|