C28H40N2O5S — CID 59105067
(1S,10R,11S,12S)-11-hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecane-7-carbonitrile (PubChem CID 59105067) has the molecular formula C28H40N2O5S and a molecular weight of 516.70 g/mol. Its IUPAC name is (1S,10R,11S,12S)-11-hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecane-7-carbonitrile.
| Compound Name | (1S,10R,11S,12S)-11-hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecane-7-carbonitrile |
|---|---|
| PubChem CID | 59105067 |
| Molecular Formula | C28H40N2O5S |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | (1S,10R,11S,12S)-11-hydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-5,9-dioxo-4,17-dioxabicyclo[14.1.0]heptadecane-7-carbonitrile |
| SMILES | C/C(=C\c1csc(C)n1)C1C[C@@H]2OC2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)C(C#N)CC(=O)O1 |
| InChI | InChI=1S/C28H40N2O5S/c1-16-9-8-10-28(7)23(35-28)13-22(17(2)11-21-15-36-19(4)30-21)34-24(31)12-20(14-29)27(5,6)26(33)18(3)25(16)32/h11,15-16,18,20,22-23,25,32H,8-10,12-13H2,1-7H3/b17-11+/t16-,18+,20?,22?,23-,25-,28?/m0/s1 |
| InChIKey | UCIWKAZENXIOAQ-WCZXZQBSSA-N |
| XLogP | 5.26 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|