C30H47NO6S — CID 58883180
(1S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6-propyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 58883180) has the molecular formula C30H47NO6S and a molecular weight of 549.77 g/mol. Its IUPAC name is (1S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6-propyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6-propyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 58883180 |
| Molecular Formula | C30H47NO6S |
| Molecular Weight | 549.77 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (1S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-[(E)-1-(2-methyl-1,3-thiazol-4-yl)prop-1-en-2-yl]-6-propyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CCCC1C(=O)OC(/C(C)=C/c2csc(C)n2)C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@H]1O |
| InChI | InChI=1S/C30H47NO6S/c1-9-11-22-27(34)29(6,7)26(33)19(4)25(32)17(2)12-10-13-30(8)24(37-30)15-23(36-28(22)35)18(3)14-21-16-38-20(5)31-21/h14,16-17,19,22-25,27,32,34H,9-13,15H2,1-8H3/b18-14+/t17-,19+,22?,23?,24-,25-,27-,30+/m0/s1 |
| InChIKey | NQWOCEYGCBRJRQ-VJKKQWKDSA-N |
| XLogP | 5.50 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|