C23H16ClF3N6 — CID 59106752
6-[2-[[2-[2-chloro-5-(trifluoromethyl)phenyl]quinazolin-4-yl]amino]ethylamino]pyridine-3-carbonitrile (PubChem CID 59106752) has the molecular formula C23H16ClF3N6 and a molecular weight of 468.87 g/mol. Its IUPAC name is 6-[2-[[2-[2-chloro-5-(trifluoromethyl)phenyl]quinazolin-4-yl]amino]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[[2-[2-chloro-5-(trifluoromethyl)phenyl]quinazolin-4-yl]amino]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 59106752 |
| Molecular Formula | C23H16ClF3N6 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 6-[2-[[2-[2-chloro-5-(trifluoromethyl)phenyl]quinazolin-4-yl]amino]ethylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCCNc2nc(-c3cc(C(F)(F)F)ccc3Cl)nc3ccccc23)nc1 |
| InChI | InChI=1S/C23H16ClF3N6/c24-18-7-6-15(23(25,26)27)11-17(18)22-32-19-4-2-1-3-16(19)21(33-22)30-10-9-29-20-8-5-14(12-28)13-31-20/h1-8,11,13H,9-10H2,(H,29,31)(H,30,32,33) |
| InChIKey | KTWCGVZOASUSCU-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|