C28H30N2O5 — CID 59107324
(2S)-N-[(1S)-1-(1,3-benzodioxol-5-yl)propyl]-2-(3-benzoyl-2-oxo-1-pyridinyl)hexanamide (PubChem CID 59107324) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-(1,3-benzodioxol-5-yl)propyl]-2-(3-benzoyl-2-oxo-1-pyridinyl)hexanamide.
| Compound Name | (2S)-N-[(1S)-1-(1,3-benzodioxol-5-yl)propyl]-2-(3-benzoyl-2-oxo-1-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 59107324 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (2S)-N-[(1S)-1-(1,3-benzodioxol-5-yl)propyl]-2-(3-benzoyl-2-oxo-1-pyridinyl)hexanamide |
| SMILES | CCCCC(C(=O)N[C@@H](CC)c1ccc2c(c1)OCO2)n1cccc(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C28H30N2O5/c1-3-5-13-23(27(32)29-22(4-2)20-14-15-24-25(17-20)35-18-34-24)30-16-9-12-21(28(30)33)26(31)19-10-7-6-8-11-19/h6-12,14-17,22-23H,3-5,13,18H2,1-2H3,(H,29,32)/t22-,23?/m0/s1 |
| InChIKey | CWXSVLCMPSBPLG-NQCNTLBGSA-N |
| XLogP | 4.81 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |