C14H18FNO2 — CID 59107352
3-[amino-(4-fluorophenyl)methyl]-5-methylhexane-2,4-dione (PubChem CID 59107352) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 3-[amino-(4-fluorophenyl)methyl]-5-methylhexane-2,4-dione.
| Compound Name | 3-[amino-(4-fluorophenyl)methyl]-5-methylhexane-2,4-dione |
|---|---|
| PubChem CID | 59107352 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 3-[amino-(4-fluorophenyl)methyl]-5-methylhexane-2,4-dione |
| SMILES | CC(=O)C(C(=O)C(C)C)C(N)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FNO2/c1-8(2)14(18)12(9(3)17)13(16)10-4-6-11(15)7-5-10/h4-8,12-13H,16H2,1-3H3 |
| InChIKey | ASMJJWHXDQUKAP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|