C22H26Cl2N2O4S2 — CID 59109609
3-[2-[(3-butyl-5-chloro-4,5,6,7-tetrahydro-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-chloro-1,3-benzothiazol-3-yl]propane-1-sulfonate (PubChem CID 59109609) has the molecular formula C22H26Cl2N2O4S2 and a molecular weight of 517.50 g/mol. Its IUPAC name is 3-[2-[(3-butyl-5-chloro-4,5,6,7-tetrahydro-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-chloro-1,3-benzothiazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(3-butyl-5-chloro-4,5,6,7-tetrahydro-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-chloro-1,3-benzothiazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59109609 |
| Molecular Formula | C22H26Cl2N2O4S2 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 3-[2-[(3-butyl-5-chloro-4,5,6,7-tetrahydro-1,3-benzoxazol-3-ium-2-yl)methylidene]-5-chloro-1,3-benzothiazol-3-yl]propane-1-sulfonate |
| SMILES | CCCC[n+]1c(C=C2Sc3ccc(Cl)cc3N2CCCS(=O)(=O)[O-])oc2c1CC(Cl)CC2 |
| InChI | InChI=1S/C22H26Cl2N2O4S2/c1-2-3-9-25-17-12-15(23)5-7-19(17)30-21(25)14-22-26(10-4-11-32(27,28)29)18-13-16(24)6-8-20(18)31-22/h6,8,13-15H,2-5,7,9-12H2,1H3 |
| InChIKey | VZLNMHYZEYFSFW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 77.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|