C17H31Cl2NOSiTi-2 — CID 59110809
tert-butyl-[dimethyl-[[(1R,2R)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy]silyl]azanide;carbanide;dichlorotitanium (PubChem CID 59110809) has the molecular formula C17H31Cl2NOSiTi-2 and a molecular weight of 412.30 g/mol. Its IUPAC name is tert-butyl-[dimethyl-[[(1R,2R)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy]silyl]azanide;carbanide;dichlorotitanium.
| Compound Name | tert-butyl-[dimethyl-[[(1R,2R)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy]silyl]azanide;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 59110809 |
| Molecular Formula | C17H31Cl2NOSiTi-2 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | tert-butyl-[dimethyl-[[(1R,2R)-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy]silyl]azanide;carbanide;dichlorotitanium |
| SMILES | C[C@@H]1CC2C=CC=CC2[C@@H]1O[Si](C)(C)[N-]C(C)(C)C.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C16H28NOSi.CH3.2ClH.Ti/c1-12-11-13-9-7-8-10-14(13)15(12)18-19(5,6)17-16(2,3)4;;;;/h7-10,12-15H,11H2,1-6H3;1H3;2*1H;/q2*-1;;;+2/p-2/t12-,13?,14?,15-;;;;/m1..../s1 |
| InChIKey | XIRVPJJMGDSOKH-PLVPTQHPSA-L |
| XLogP | 6.47 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|