C21H24O8 — CID 59110951
5-[(2E,4E,6E)-7-(4-hydroxy-2-methyl-6-oxo-2-propan-2-yl-1,3-dioxin-5-yl)hepta-2,4,6-trienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 59110951) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is 5-[(2E,4E,6E)-7-(4-hydroxy-2-methyl-6-oxo-2-propan-2-yl-1,3-dioxin-5-yl)hepta-2,4,6-trienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2E,4E,6E)-7-(4-hydroxy-2-methyl-6-oxo-2-propan-2-yl-1,3-dioxin-5-yl)hepta-2,4,6-trienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 59110951 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 5-[(2E,4E,6E)-7-(4-hydroxy-2-methyl-6-oxo-2-propan-2-yl-1,3-dioxin-5-yl)hepta-2,4,6-trienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(C)C1(C)OC(=O)C(/C=C/C=C/C=C/C=C2C(=O)OC(C)(C)OC2=O)=C(O)O1 |
| InChI | InChI=1S/C21H24O8/c1-13(2)21(5)28-18(24)15(19(25)29-21)12-10-8-6-7-9-11-14-16(22)26-20(3,4)27-17(14)23/h6-13,24H,1-5H3/b8-6+,9-7+,12-10+ |
| InChIKey | WEUANDBJWPECGN-CAPISXRISA-N |
| XLogP | 3.13 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|