C18H26O5S — CID 59111653
(3R)-13-methyl-3-(trioxidanylsulfanyloxy)-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 59111653) has the molecular formula C18H26O5S and a molecular weight of 354.47 g/mol. Its IUPAC name is (3R)-13-methyl-3-(trioxidanylsulfanyloxy)-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R)-13-methyl-3-(trioxidanylsulfanyloxy)-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 59111653 |
| Molecular Formula | C18H26O5S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (3R)-13-methyl-3-(trioxidanylsulfanyloxy)-2,3,4,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3C4=C(CCC3C1CCC2=O)C[C@H](OSOOO)CC4 |
| InChI | InChI=1S/C18H26O5S/c1-18-9-8-14-13-5-3-12(21-24-23-22-20)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h12,14-16,20H,2-10H2,1H3/t12-,14?,15?,16?,18?/m1/s1 |
| InChIKey | DZZJKXDSHXLVNL-XSOSOZTNSA-N |
| XLogP | 4.64 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|