C21H29FO3 — CID 3268846
(9-fluoro-16-methyl-15-oxo-5-tetracyclo[9.7.0.02,7.012,16]octadec-2(7)-enyl) acetate (PubChem CID 3268846) has the molecular formula C21H29FO3 and a molecular weight of 348.46 g/mol. Its IUPAC name is (9-fluoro-16-methyl-15-oxo-5-tetracyclo[9.7.0.02,7.012,16]octadec-2(7)-enyl) acetate.
| Compound Name | (9-fluoro-16-methyl-15-oxo-5-tetracyclo[9.7.0.02,7.012,16]octadec-2(7)-enyl) acetate |
|---|---|
| PubChem CID | 3268846 |
| Molecular Formula | C21H29FO3 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (9-fluoro-16-methyl-15-oxo-5-tetracyclo[9.7.0.02,7.012,16]octadec-2(7)-enyl) acetate |
| SMILES | CC(=O)OC1CCC2=C(CC(F)CC3C2CCC2(C)C(=O)CCC32)C1 |
| InChI | InChI=1S/C21H29FO3/c1-12(23)25-15-3-4-16-13(10-15)9-14(22)11-18-17(16)7-8-21(2)19(18)5-6-20(21)24/h14-15,17-19H,3-11H2,1-2H3 |
| InChIKey | IGRWPBROGNPQRG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|