C30H40O4 — CID 102292196
[(1S,5S,9R,11S,12S,15S,16S)-15-acetyl-9-(4-methoxyphenyl)-16-methyl-5-tetracyclo[9.7.0.02,7.012,16]octadec-2(7)-enyl] acetate (PubChem CID 102292196) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is [(1S,5S,9R,11S,12S,15S,16S)-15-acetyl-9-(4-methoxyphenyl)-16-methyl-5-tetracyclo[9.7.0.02,7.012,16]octadec-2(7)-enyl] acetate.
| Compound Name | [(1S,5S,9R,11S,12S,15S,16S)-15-acetyl-9-(4-methoxyphenyl)-16-methyl-5-tetracyclo[9.7.0.02,7.012,16]octadec-2(7)-enyl] acetate |
|---|---|
| PubChem CID | 102292196 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | [(1S,5S,9R,11S,12S,15S,16S)-15-acetyl-9-(4-methoxyphenyl)-16-methyl-5-tetracyclo[9.7.0.02,7.012,16]octadec-2(7)-enyl] acetate |
| SMILES | COc1ccc([C@H]2CC3=C(CC[C@H](OC(C)=O)C3)[C@H]3CC[C@]4(C)[C@@H](C(C)=O)CC[C@H]4[C@@H]3C2)cc1 |
| InChI | InChI=1S/C30H40O4/c1-18(31)28-11-12-29-27-17-21(20-5-7-23(33-4)8-6-20)15-22-16-24(34-19(2)32)9-10-25(22)26(27)13-14-30(28,29)3/h5-8,21,24,26-29H,9-17H2,1-4H3/t21-,24-,26+,27+,28+,29-,30+/m0/s1 |
| InChIKey | JOBNWQRGUUERRW-YPIRXXHISA-N |
| XLogP | 6.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|