C23H33FO5S — CID 164670514
[(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-6-fluorosulfonyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 164670514) has the molecular formula C23H33FO5S and a molecular weight of 440.58 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-6-fluorosulfonyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-6-fluorosulfonyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 164670514 |
| Molecular Formula | C23H33FO5S |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-17-acetyl-6-fluorosulfonyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=C(S(=O)(=O)F)C[C@H]3[C@@H]4CC[C@H](C(C)=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C23H33FO5S/c1-13(25)17-5-6-18-16-12-21(30(24,27)28)20-11-15(29-14(2)26)7-9-23(20,4)19(16)8-10-22(17,18)3/h15-19H,5-12H2,1-4H3/t15-,16-,17+,18-,19-,22+,23+/m0/s1 |
| InChIKey | RRHAIOWMLKVXDE-DLIVVPPJSA-N |
| XLogP | 4.71 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |