C12H15NO2 — CID 591156
4,7,7-trimethyl-6,8-dihydro-1H-quinoline-2,5-dione (PubChem CID 591156) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 4,7,7-trimethyl-6,8-dihydro-1H-quinoline-2,5-dione.
| Compound Name | 4,7,7-trimethyl-6,8-dihydro-1H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 591156 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4,7,7-trimethyl-6,8-dihydro-1H-quinoline-2,5-dione |
| SMILES | Cc1cc(=O)[nH]c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C12H15NO2/c1-7-4-10(15)13-8-5-12(2,3)6-9(14)11(7)8/h4H,5-6H2,1-3H3,(H,13,15) |
| InChIKey | RCJKXGVTRMHHRM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |