C14H19NO2 — CID 822396
1-ethyl-4,7,7-trimethyl-6,8-dihydroquinoline-2,5-dione (PubChem CID 822396) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-ethyl-4,7,7-trimethyl-6,8-dihydroquinoline-2,5-dione.
| Compound Name | 1-ethyl-4,7,7-trimethyl-6,8-dihydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 822396 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-ethyl-4,7,7-trimethyl-6,8-dihydroquinoline-2,5-dione |
| SMILES | CCn1c2c(c(C)cc1=O)C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C14H19NO2/c1-5-15-10-7-14(3,4)8-11(16)13(10)9(2)6-12(15)17/h6H,5,7-8H2,1-4H3 |
| InChIKey | AYMFPCDOUSZSPF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |