C14H17NO2 — CID 10105297
1-(3-methylbut-2-enyl)-7,8-dihydro-6H-quinoline-2,5-dione (PubChem CID 10105297) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-7,8-dihydro-6H-quinoline-2,5-dione.
| Compound Name | 1-(3-methylbut-2-enyl)-7,8-dihydro-6H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 10105297 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-7,8-dihydro-6H-quinoline-2,5-dione |
| SMILES | CC(C)=CCn1c2c(ccc1=O)C(=O)CCC2 |
| InChI | InChI=1S/C14H17NO2/c1-10(2)8-9-15-12-4-3-5-13(16)11(12)6-7-14(15)17/h6-8H,3-5,9H2,1-2H3 |
| InChIKey | JHBYKHOQCUGISC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|