C12H13NO2 — CID 10330512
1-prop-2-enyl-7,8-dihydro-6H-quinoline-2,5-dione (PubChem CID 10330512) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-prop-2-enyl-7,8-dihydro-6H-quinoline-2,5-dione.
| Compound Name | 1-prop-2-enyl-7,8-dihydro-6H-quinoline-2,5-dione |
|---|---|
| PubChem CID | 10330512 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1-prop-2-enyl-7,8-dihydro-6H-quinoline-2,5-dione |
| SMILES | C=CCn1c2c(ccc1=O)C(=O)CCC2 |
| InChI | InChI=1S/C12H13NO2/c1-2-8-13-10-4-3-5-11(14)9(10)6-7-12(13)15/h2,6-7H,1,3-5,8H2 |
| InChIKey | ISHPVKDXDAAACO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|