C7H14AcNO- — CID 59116522
actinium;1-(methanidylamino)-3,3-dimethylbutan-2-one (PubChem CID 59116522) has the molecular formula C7H14AcNO- and a molecular weight of 355.20 g/mol. Its IUPAC name is actinium;1-(methanidylamino)-3,3-dimethylbutan-2-one.
| Compound Name | actinium;1-(methanidylamino)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 59116522 |
| Molecular Formula | C7H14AcNO- |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | actinium;1-(methanidylamino)-3,3-dimethylbutan-2-one |
| SMILES | [Ac].[CH2-]NCC(=O)C(C)(C)C |
| InChI | InChI=1S/C7H14NO.Ac/c1-7(2,3)6(9)5-8-4;/h8H,4-5H2,1-3H3;/q-1; |
| InChIKey | TXAOPZKEIBNZIJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|