C15H14FN3O2 — CID 59116559
[1-(4-cyano-3-fluorophenyl)-1-(1-methylimidazol-4-yl)ethyl] acetate (PubChem CID 59116559) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is [1-(4-cyano-3-fluorophenyl)-1-(1-methylimidazol-4-yl)ethyl] acetate.
| Compound Name | [1-(4-cyano-3-fluorophenyl)-1-(1-methylimidazol-4-yl)ethyl] acetate |
|---|---|
| PubChem CID | 59116559 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [1-(4-cyano-3-fluorophenyl)-1-(1-methylimidazol-4-yl)ethyl] acetate |
| SMILES | CC(=O)OC(C)(c1ccc(C#N)c(F)c1)c1cn(C)cn1 |
| InChI | InChI=1S/C15H14FN3O2/c1-10(20)21-15(2,14-8-19(3)9-18-14)12-5-4-11(7-17)13(16)6-12/h4-6,8-9H,1-3H3 |
| InChIKey | MNNWKCVGMIYDCY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |