About pentan-3-one;yttrium
pentan-3-one;yttrium (PubChem CID 59118360) has the molecular formula C5H9OY-
and a molecular weight of 174.03 g/mol. Its IUPAC name is pentan-3-one;yttrium.
Molecular Properties
| Compound Name | pentan-3-one;yttrium |
| PubChem CID | 59118360 |
| Molecular Formula | C5H9OY- |
| Molecular Weight | 174.03 g/mol |
| Exact Mass | 173.97 |
| IUPAC Name | pentan-3-one;yttrium |
| SMILES | C[CH-]C(=O)CC.[Y] |
| InChI | InChI=1S/C5H9O.Y/c1-3-5(6)4-2;/h3H,4H2,1-2H3;/q-1; |
| InChIKey | NAHBSBMTCVRLOM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.03 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-one;yttrium?
The IUPAC name of pentan-3-one;yttrium (CID 59118360) is pentan-3-one;yttrium.
What is the SMILES notation for pentan-3-one;yttrium?
The canonical SMILES for pentan-3-one;yttrium is C[CH-]C(=O)CC.[Y].
What is the InChIKey of pentan-3-one;yttrium?
The InChIKey is NAHBSBMTCVRLOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O.Y/c1-3-5(6)4-2;/h3H,4H2,1-2H3;/q-1;.
What are the key properties of pentan-3-one;yttrium?
pentan-3-one;yttrium has a molecular weight of 174.03 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-one;yttrium is sourced from PubChem (CID 59118360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).