About 1-aminobutan-2-one;rhenium
1-aminobutan-2-one;rhenium (PubChem CID 163779097) has the molecular formula C4H8NORe-
and a molecular weight of 272.32 g/mol. Its IUPAC name is 1-aminobutan-2-one;rhenium.
Molecular Properties
| Compound Name | 1-aminobutan-2-one;rhenium |
| PubChem CID | 163779097 |
| Molecular Formula | C4H8NORe- |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-aminobutan-2-one;rhenium |
| SMILES | CCC(=O)[CH-]N.[Re] |
| InChI | InChI=1S/C4H8NO.Re/c1-2-4(6)3-5;/h3H,2,5H2,1H3;/q-1; |
| InChIKey | VJERJZZSZZILIC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-aminobutan-2-one;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminobutan-2-one;rhenium?
The IUPAC name of 1-aminobutan-2-one;rhenium (CID 163779097) is 1-aminobutan-2-one;rhenium.
What is the SMILES notation for 1-aminobutan-2-one;rhenium?
The canonical SMILES for 1-aminobutan-2-one;rhenium is CCC(=O)[CH-]N.[Re].
What is the InChIKey of 1-aminobutan-2-one;rhenium?
The InChIKey is VJERJZZSZZILIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NO.Re/c1-2-4(6)3-5;/h3H,2,5H2,1H3;/q-1;.
What are the key properties of 1-aminobutan-2-one;rhenium?
1-aminobutan-2-one;rhenium has a molecular weight of 272.32 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminobutan-2-one;rhenium is sourced from PubChem (CID 163779097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).