About CID 20612499
CID 20612499 (PubChem CID 20612499) has the molecular formula C4H11BNOP2W-
and a molecular weight of 345.74 g/mol.
Molecular Properties
| Compound Name | CID 20612499 |
| PubChem CID | 20612499 |
| Molecular Formula | C4H11BNOP2W- |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | — |
| SMILES | CCC(=O)[CH-]NP.[B]P.[W] |
| InChI | InChI=1S/C4H9NOP.BH2P.W/c1-2-4(6)3-5-7;1-2;/h3,5H,2,7H2,1H3;2H2;/q-1;; |
| InChIKey | AGVDCFJHDLPHGO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 20612499 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20612499?
The IUPAC name of CID 20612499 (CID 20612499) is not available.
What is the SMILES notation for CID 20612499?
The canonical SMILES for CID 20612499 is CCC(=O)[CH-]NP.[B]P.[W].
What is the InChIKey of CID 20612499?
The InChIKey is AGVDCFJHDLPHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NOP.BH2P.W/c1-2-4(6)3-5-7;1-2;/h3,5H,2,7H2,1H3;2H2;/q-1;;.
What are the key properties of CID 20612499?
CID 20612499 has a molecular weight of 345.74 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20612499 is sourced from PubChem (CID 20612499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).