About CID 91279808
CID 91279808 (PubChem CID 91279808) has the molecular formula C4H9BO2
and a molecular weight of 99.93 g/mol.
Molecular Properties
| Compound Name | CID 91279808 |
| PubChem CID | 91279808 |
| Molecular Formula | C4H9BO2 |
| Molecular Weight | 99.93 g/mol |
| Exact Mass | 100.07 |
| IUPAC Name | — |
| SMILES | CCC(=O)O.[B]C |
| InChI | InChI=1S/C3H6O2.CH3B/c1-2-3(4)5;1-2/h2H2,1H3,(H,4,5);1H3 |
| InChIKey | DMXWPOJOHMCDKP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.93 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 91279808 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91279808?
The IUPAC name of CID 91279808 (CID 91279808) is not available.
What is the SMILES notation for CID 91279808?
The canonical SMILES for CID 91279808 is CCC(=O)O.[B]C.
What is the InChIKey of CID 91279808?
The InChIKey is DMXWPOJOHMCDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.CH3B/c1-2-3(4)5;1-2/h2H2,1H3,(H,4,5);1H3.
What are the key properties of CID 91279808?
CID 91279808 has a molecular weight of 99.93 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91279808 is sourced from PubChem (CID 91279808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).