C10H19N3O6 — CID 59121434
4-amino-3-[(1-amino-3-carboxypropan-2-yl)-(1-hydroperoxyethenyl)amino]butanoic acid (PubChem CID 59121434) has the molecular formula C10H19N3O6 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-amino-3-[(1-amino-3-carboxypropan-2-yl)-(1-hydroperoxyethenyl)amino]butanoic acid.
| Compound Name | 4-amino-3-[(1-amino-3-carboxypropan-2-yl)-(1-hydroperoxyethenyl)amino]butanoic acid |
|---|---|
| PubChem CID | 59121434 |
| Molecular Formula | C10H19N3O6 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 4-amino-3-[(1-amino-3-carboxypropan-2-yl)-(1-hydroperoxyethenyl)amino]butanoic acid |
| SMILES | C=C(OO)N(C(CN)CC(=O)O)C(CN)CC(=O)O |
| InChI | InChI=1S/C10H19N3O6/c1-6(19-18)13(7(4-11)2-9(14)15)8(5-12)3-10(16)17/h7-8,18H,1-5,11-12H2,(H,14,15)(H,16,17) |
| InChIKey | NTQLMXZDTVOFFC-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|