C31H38N4O3 — CID 59122643
tert-butyl 4-[(2R)-9-[(1R)-1-hydroxy-1-(3-methylimidazol-4-yl)ethyl]-6-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]piperazine-1-carboxylate (PubChem CID 59122643) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is tert-butyl 4-[(2R)-9-[(1R)-1-hydroxy-1-(3-methylimidazol-4-yl)ethyl]-6-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2R)-9-[(1R)-1-hydroxy-1-(3-methylimidazol-4-yl)ethyl]-6-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59122643 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | tert-butyl 4-[(2R)-9-[(1R)-1-hydroxy-1-(3-methylimidazol-4-yl)ethyl]-6-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc2c(c1)C([C@@](C)(O)c1cncn1C)=Cc1ccccc1[C@H]2N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H38N4O3/c1-21-11-12-24-25(17-21)26(31(5,37)27-19-32-20-33(27)6)18-22-9-7-8-10-23(22)28(24)34-13-15-35(16-14-34)29(36)38-30(2,3)4/h7-12,17-20,28,37H,13-16H2,1-6H3/t28-,31-/m1/s1 |
| InChIKey | MYGYGZZRJMYTKG-GRKNLSHJSA-N |
| XLogP | 5.13 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|