C29H36N8O2 — CID 70995821
tert-butyl 4-[(2S)-10-[azido-(3-methyl-4,5-dihydroimidazol-4-yl)methyl]-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxylate (PubChem CID 70995821) has the molecular formula C29H36N8O2 and a molecular weight of 528.66 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-10-[azido-(3-methyl-4,5-dihydroimidazol-4-yl)methyl]-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-10-[azido-(3-methyl-4,5-dihydroimidazol-4-yl)methyl]-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70995821 |
| Molecular Formula | C29H36N8O2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | tert-butyl 4-[(2S)-10-[azido-(3-methyl-4,5-dihydroimidazol-4-yl)methyl]-13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-yl]piperazine-1-carboxylate |
| SMILES | Cc1ccc2c(c1)C(C(N=[N+]=[N-])C1CN=CN1C)=Cc1cccnc1[C@H]2N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C29H36N8O2/c1-19-8-9-21-22(15-19)23(26(33-34-30)24-17-31-18-35(24)5)16-20-7-6-10-32-25(20)27(21)36-11-13-37(14-12-36)28(38)39-29(2,3)4/h6-10,15-16,18,24,26-27H,11-14,17H2,1-5H3/t24?,26?,27-/m0/s1 |
| InChIKey | FQHBFMPECXZQKB-SDMRFKEVSA-N |
| XLogP | 4.91 |
| TPSA | 110.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|