About 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one
4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one (PubChem CID 59123901) has the molecular formula C12H21NOS
and a molecular weight of 227.37 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one.
Molecular Properties
| Compound Name | 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one |
| PubChem CID | 59123901 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one |
| SMILES | Cn1sc(C(C)(C)C)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C12H21NOS/c1-11(2,3)8-9(12(4,5)6)15-13(7)10(8)14/h1-7H3 |
| InChIKey | JBWXJDCXGNKFBA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one?
The IUPAC name of 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one (CID 59123901) is 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one.
What is the SMILES notation for 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one?
The canonical SMILES for 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one is Cn1sc(C(C)(C)C)c(C(C)(C)C)c1=O.
What is the InChIKey of 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one?
The InChIKey is JBWXJDCXGNKFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NOS/c1-11(2,3)8-9(12(4,5)6)15-13(7)10(8)14/h1-7H3.
What are the key properties of 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one?
4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one has a molecular weight of 227.37 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butyl-2-methyl-1,2-thiazol-3-one is sourced from PubChem (CID 59123901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).