C15H27NOS — CID 21060921
2-butyl-4,5-ditert-butyl-1,2-thiazol-3-one (PubChem CID 21060921) has the molecular formula C15H27NOS and a molecular weight of 269.45 g/mol. Its IUPAC name is 2-butyl-4,5-ditert-butyl-1,2-thiazol-3-one.
| Compound Name | 2-butyl-4,5-ditert-butyl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 21060921 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-butyl-4,5-ditert-butyl-1,2-thiazol-3-one |
| SMILES | CCCCn1sc(C(C)(C)C)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C15H27NOS/c1-8-9-10-16-13(17)11(14(2,3)4)12(18-16)15(5,6)7/h8-10H2,1-7H3 |
| InChIKey | DSOJIXOIROVRHO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |