C15H28N2OS — CID 59105256
3-butyl-5,6-ditert-butyl-2H-thiadiazin-4-one (PubChem CID 59105256) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is 3-butyl-5,6-ditert-butyl-2H-thiadiazin-4-one.
| Compound Name | 3-butyl-5,6-ditert-butyl-2H-thiadiazin-4-one |
|---|---|
| PubChem CID | 59105256 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 3-butyl-5,6-ditert-butyl-2H-thiadiazin-4-one |
| SMILES | CCCCN1NSC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H28N2OS/c1-8-9-10-17-13(18)11(14(2,3)4)12(19-16-17)15(5,6)7/h16H,8-10H2,1-7H3 |
| InChIKey | QBSOEHHHAPFPMC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|