C17H30N2O2 — CID 23402538
1-butyl-4,5-ditert-butyl-2-methylpyridazine-3,6-dione (PubChem CID 23402538) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-butyl-4,5-ditert-butyl-2-methylpyridazine-3,6-dione.
| Compound Name | 1-butyl-4,5-ditert-butyl-2-methylpyridazine-3,6-dione |
|---|---|
| PubChem CID | 23402538 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1-butyl-4,5-ditert-butyl-2-methylpyridazine-3,6-dione |
| SMILES | CCCCn1c(=O)c(C(C)(C)C)c(C(C)(C)C)c(=O)n1C |
| InChI | InChI=1S/C17H30N2O2/c1-9-10-11-19-15(21)13(17(5,6)7)12(16(2,3)4)14(20)18(19)8/h9-11H2,1-8H3 |
| InChIKey | BUBMAFJGJBSDDF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |