C16H28N2O — CID 20872023
2-butyl-4,5-ditert-butylpyridazin-3-one (PubChem CID 20872023) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-butyl-4,5-ditert-butylpyridazin-3-one.
| Compound Name | 2-butyl-4,5-ditert-butylpyridazin-3-one |
|---|---|
| PubChem CID | 20872023 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 2-butyl-4,5-ditert-butylpyridazin-3-one |
| SMILES | CCCCn1ncc(C(C)(C)C)c(C(C)(C)C)c1=O |
| InChI | InChI=1S/C16H28N2O/c1-8-9-10-18-14(19)13(16(5,6)7)12(11-17-18)15(2,3)4/h11H,8-10H2,1-7H3 |
| InChIKey | NVUFJWTZHJYTSY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |