C17H30N2O — CID 139337851
2,4-ditert-butyl-5-(2,2-dimethylpropyl)pyridazin-3-one (PubChem CID 139337851) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is 2,4-ditert-butyl-5-(2,2-dimethylpropyl)pyridazin-3-one.
| Compound Name | 2,4-ditert-butyl-5-(2,2-dimethylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 139337851 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2,4-ditert-butyl-5-(2,2-dimethylpropyl)pyridazin-3-one |
| SMILES | CC(C)(C)Cc1cnn(C(C)(C)C)c(=O)c1C(C)(C)C |
| InChI | InChI=1S/C17H30N2O/c1-15(2,3)10-12-11-18-19(17(7,8)9)14(20)13(12)16(4,5)6/h11H,10H2,1-9H3 |
| InChIKey | UQCVYSWJODLUHR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |