C17H32N2O — CID 20871968
2-butyl-4,5-ditert-butyl-1-methyl-3H-pyridazin-6-one (PubChem CID 20871968) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 2-butyl-4,5-ditert-butyl-1-methyl-3H-pyridazin-6-one.
| Compound Name | 2-butyl-4,5-ditert-butyl-1-methyl-3H-pyridazin-6-one |
|---|---|
| PubChem CID | 20871968 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 2-butyl-4,5-ditert-butyl-1-methyl-3H-pyridazin-6-one |
| SMILES | CCCCN1CC(C(C)(C)C)=C(C(C)(C)C)C(=O)N1C |
| InChI | InChI=1S/C17H32N2O/c1-9-10-11-19-12-13(16(2,3)4)14(17(5,6)7)15(20)18(19)8/h9-12H2,1-8H3 |
| InChIKey | FDLUSLGDFSRMRP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |