About 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione
4,5-diethyl-1,2-dimethylpyridazine-3,6-dione (PubChem CID 118408753) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione.
Molecular Properties
| Compound Name | 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione |
| PubChem CID | 118408753 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione |
| SMILES | CCc1c(CC)c(=O)n(C)n(C)c1=O |
| InChI | InChI=1S/C10H16N2O2/c1-5-7-8(6-2)10(14)12(4)11(3)9(7)13/h5-6H2,1-4H3 |
| InChIKey | AUIFSJGXBMLLSI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione?
The IUPAC name of 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione (CID 118408753) is 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione.
What is the SMILES notation for 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione?
The canonical SMILES for 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione is CCc1c(CC)c(=O)n(C)n(C)c1=O.
What is the InChIKey of 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione?
The InChIKey is AUIFSJGXBMLLSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-5-7-8(6-2)10(14)12(4)11(3)9(7)13/h5-6H2,1-4H3.
What are the key properties of 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione?
4,5-diethyl-1,2-dimethylpyridazine-3,6-dione has a molecular weight of 196.25 g/mol, XLogP of 0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethyl-1,2-dimethylpyridazine-3,6-dione is sourced from PubChem (CID 118408753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).