C14H24N2O2 — CID 20871956
4,5-ditert-butyl-1,2-dimethylpyridazine-3,6-dione (PubChem CID 20871956) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4,5-ditert-butyl-1,2-dimethylpyridazine-3,6-dione.
| Compound Name | 4,5-ditert-butyl-1,2-dimethylpyridazine-3,6-dione |
|---|---|
| PubChem CID | 20871956 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 4,5-ditert-butyl-1,2-dimethylpyridazine-3,6-dione |
| SMILES | Cn1c(=O)c(C(C)(C)C)c(C(C)(C)C)c(=O)n1C |
| InChI | InChI=1S/C14H24N2O2/c1-13(2,3)9-10(14(4,5)6)12(18)16(8)15(7)11(9)17/h1-8H3 |
| InChIKey | LDGOAGKXHKXBCR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |