About actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium
actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium (PubChem CID 59124069) has the molecular formula C13H20AcNO2+
and a molecular weight of 449.31 g/mol. Its IUPAC name is actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium.
Molecular Properties
| Compound Name | actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium |
| PubChem CID | 59124069 |
| Molecular Formula | C13H20AcNO2+ |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium |
| SMILES | CCCc1cc(C[C@H]([NH3+])C(C)=O)ccc1O.[Ac] |
| InChI | InChI=1S/C13H19NO2.Ac/c1-3-4-11-7-10(5-6-13(11)16)8-12(14)9(2)15;/h5-7,12,16H,3-4,8,14H2,1-2H3;/p+1/t12-;/m0./s1 |
| InChIKey | IKVCUDNQHSADMN-YDALLXLXSA-O |
| XLogP | 1.09 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium?
The IUPAC name of actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium (CID 59124069) is actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium.
What is the SMILES notation for actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium?
The canonical SMILES for actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium is CCCc1cc(C[C@H]([NH3+])C(C)=O)ccc1O.[Ac].
What is the InChIKey of actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium?
The InChIKey is IKVCUDNQHSADMN-YDALLXLXSA-O. The full InChI is InChI=1S/C13H19NO2.Ac/c1-3-4-11-7-10(5-6-13(11)16)8-12(14)9(2)15;/h5-7,12,16H,3-4,8,14H2,1-2H3;/p+1/t12-;/m0./s1.
What are the key properties of actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium?
actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium has a molecular weight of 449.31 g/mol, XLogP of 1.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;[(2S)-1-(4-hydroxy-3-propylphenyl)-3-oxobutan-2-yl]azanium is sourced from PubChem (CID 59124069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).