C17H17ClFN2O2Y- — CID 59124225
5-(2-chloro-6-fluorophenyl)-N-cyclohexyl-3-methyl-1,2-oxazole-4-carboxamide;yttrium (PubChem CID 59124225) has the molecular formula C17H17ClFN2O2Y- and a molecular weight of 424.69 g/mol. Its IUPAC name is 5-(2-chloro-6-fluorophenyl)-N-cyclohexyl-3-methyl-1,2-oxazole-4-carboxamide;yttrium.
| Compound Name | 5-(2-chloro-6-fluorophenyl)-N-cyclohexyl-3-methyl-1,2-oxazole-4-carboxamide;yttrium |
|---|---|
| PubChem CID | 59124225 |
| Molecular Formula | C17H17ClFN2O2Y- |
| Molecular Weight | 424.69 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 5-(2-chloro-6-fluorophenyl)-N-cyclohexyl-3-methyl-1,2-oxazole-4-carboxamide;yttrium |
| SMILES | Cc1noc(-c2c(F)cccc2Cl)c1C(=O)NC1C[CH-]CCC1.[Y] |
| InChI | InChI=1S/C17H17ClFN2O2.Y/c1-10-14(17(22)20-11-6-3-2-4-7-11)16(23-21-10)15-12(18)8-5-9-13(15)19;/h3,5,8-9,11H,2,4,6-7H2,1H3,(H,20,22);/q-1; |
| InChIKey | PYXIRVRWBFPUBV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.69 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|