C18H25NO5 — CID 59125285
propyl (1S,2R,8R,8aR)-1,2,8-trihydroxy-5-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylate (PubChem CID 59125285) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is propyl (1S,2R,8R,8aR)-1,2,8-trihydroxy-5-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylate.
| Compound Name | propyl (1S,2R,8R,8aR)-1,2,8-trihydroxy-5-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylate |
|---|---|
| PubChem CID | 59125285 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | propyl (1S,2R,8R,8aR)-1,2,8-trihydroxy-5-phenyl-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylate |
| SMILES | CCCOC(=O)C1C[C@@H](O)[C@@H]2[C@H](O)[C@H](O)CN2C1c1ccccc1 |
| InChI | InChI=1S/C18H25NO5/c1-2-8-24-18(23)12-9-13(20)16-17(22)14(21)10-19(16)15(12)11-6-4-3-5-7-11/h3-7,12-17,20-22H,2,8-10H2,1H3/t12?,13-,14-,15?,16-,17-/m1/s1 |
| InChIKey | IIBLSLDHOKRUBH-MLGCDVQBSA-N |
| XLogP | 0.47 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |