C22H29N3O5S — CID 59125838
[1,3-dimethyl-4-(4,4,5,8-tetramethyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)pyrazol-5-yl] N,N-dimethylcarbamate (PubChem CID 59125838) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is [1,3-dimethyl-4-(4,4,5,8-tetramethyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)pyrazol-5-yl] N,N-dimethylcarbamate.
| Compound Name | [1,3-dimethyl-4-(4,4,5,8-tetramethyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)pyrazol-5-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 59125838 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [1,3-dimethyl-4-(4,4,5,8-tetramethyl-1,1-dioxo-2,3-dihydrothiochromene-6-carbonyl)pyrazol-5-yl] N,N-dimethylcarbamate |
| SMILES | Cc1cc(C(=O)c2c(C)nn(C)c2OC(=O)N(C)C)c(C)c2c1S(=O)(=O)CCC2(C)C |
| InChI | InChI=1S/C22H29N3O5S/c1-12-11-15(13(2)17-19(12)31(28,29)10-9-22(17,4)5)18(26)16-14(3)23-25(8)20(16)30-21(27)24(6)7/h11H,9-10H2,1-8H3 |
| InChIKey | YCVKSSVUNJIEER-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |