C26H38N6O — CID 59127204
1-[3-(2-methylpiperidin-1-yl)propyl]-6-[3-[methyl(pyridin-2-ylmethyl)amino]propoxy]benzimidazol-2-amine (PubChem CID 59127204) has the molecular formula C26H38N6O and a molecular weight of 450.63 g/mol. Its IUPAC name is 1-[3-(2-methylpiperidin-1-yl)propyl]-6-[3-[methyl(pyridin-2-ylmethyl)amino]propoxy]benzimidazol-2-amine.
| Compound Name | 1-[3-(2-methylpiperidin-1-yl)propyl]-6-[3-[methyl(pyridin-2-ylmethyl)amino]propoxy]benzimidazol-2-amine |
|---|---|
| PubChem CID | 59127204 |
| Molecular Formula | C26H38N6O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 1-[3-(2-methylpiperidin-1-yl)propyl]-6-[3-[methyl(pyridin-2-ylmethyl)amino]propoxy]benzimidazol-2-amine |
| SMILES | CC1CCCCN1CCCn1c(N)nc2ccc(OCCCN(C)Cc3ccccn3)cc21 |
| InChI | InChI=1S/C26H38N6O/c1-21-9-4-6-15-31(21)16-7-17-32-25-19-23(11-12-24(25)29-26(32)27)33-18-8-14-30(2)20-22-10-3-5-13-28-22/h3,5,10-13,19,21H,4,6-9,14-18,20H2,1-2H3,(H2,27,29) |
| InChIKey | TXBRKSIMDJQDMR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|