C19H28N2O2 — CID 155528188
2-methyl-7-[3-(2-methylpiperidin-1-yl)propoxy]-3,4-dihydroisoquinolin-1-one (PubChem CID 155528188) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-methyl-7-[3-(2-methylpiperidin-1-yl)propoxy]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-methyl-7-[3-(2-methylpiperidin-1-yl)propoxy]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 155528188 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-methyl-7-[3-(2-methylpiperidin-1-yl)propoxy]-3,4-dihydroisoquinolin-1-one |
| SMILES | CC1CCCCN1CCCOc1ccc2c(c1)C(=O)N(C)CC2 |
| InChI | InChI=1S/C19H28N2O2/c1-15-6-3-4-10-21(15)11-5-13-23-17-8-7-16-9-12-20(2)19(22)18(16)14-17/h7-8,14-15H,3-6,9-13H2,1-2H3 |
| InChIKey | NQIHRGRHGKXFDW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|