C24H27N3O2 — CID 46866127
4-[6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2-oxo-3,4-dihydroquinolin-1-yl]benzonitrile (PubChem CID 46866127) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2-oxo-3,4-dihydroquinolin-1-yl]benzonitrile.
| Compound Name | 4-[6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2-oxo-3,4-dihydroquinolin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 46866127 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 4-[6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2-oxo-3,4-dihydroquinolin-1-yl]benzonitrile |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc2c(c1)CCC(=O)N2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-18-4-2-13-26(18)14-3-15-29-22-10-11-23-20(16-22)7-12-24(28)27(23)21-8-5-19(17-25)6-9-21/h5-6,8-11,16,18H,2-4,7,12-15H2,1H3/t18-/m1/s1 |
| InChIKey | CKLUCMNOSIDHKJ-GOSISDBHSA-N |
| XLogP | 4.42 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|