C26H33N3O3 — CID 66681824
N,N-dimethyl-3-[6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2-oxo-3,4-dihydroquinolin-1-yl]benzamide (PubChem CID 66681824) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N,N-dimethyl-3-[6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2-oxo-3,4-dihydroquinolin-1-yl]benzamide.
| Compound Name | N,N-dimethyl-3-[6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2-oxo-3,4-dihydroquinolin-1-yl]benzamide |
|---|---|
| PubChem CID | 66681824 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N,N-dimethyl-3-[6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-2-oxo-3,4-dihydroquinolin-1-yl]benzamide |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc2c(c1)CCC(=O)N2c1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-19-7-5-14-28(19)15-6-16-32-23-11-12-24-20(18-23)10-13-25(30)29(24)22-9-4-8-21(17-22)26(31)27(2)3/h4,8-9,11-12,17-19H,5-7,10,13-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | CBFOKDJIWMNZSS-LJQANCHMSA-N |
| XLogP | 4.25 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|