C26H29N3O3 — CID 66683433
6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-1-[4-(1,3-oxazol-5-yl)phenyl]-3,4-dihydroquinolin-2-one (PubChem CID 66683433) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-1-[4-(1,3-oxazol-5-yl)phenyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-1-[4-(1,3-oxazol-5-yl)phenyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 66683433 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 6-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]-1-[4-(1,3-oxazol-5-yl)phenyl]-3,4-dihydroquinolin-2-one |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc2c(c1)CCC(=O)N2c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C26H29N3O3/c1-19-4-2-13-28(19)14-3-15-31-23-10-11-24-21(16-23)7-12-26(30)29(24)22-8-5-20(6-9-22)25-17-27-18-32-25/h5-6,8-11,16-19H,2-4,7,12-15H2,1H3/t19-/m1/s1 |
| InChIKey | DOZFLBWJVOFSFI-LJQANCHMSA-N |
| XLogP | 5.21 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|