C23H35N3O2 — CID 16662600
(5S)-1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-5-(pyrrolidin-1-ylmethyl)pyrrolidin-2-one (PubChem CID 16662600) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is (5S)-1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-5-(pyrrolidin-1-ylmethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-5-(pyrrolidin-1-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 16662600 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | (5S)-1-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-5-(pyrrolidin-1-ylmethyl)pyrrolidin-2-one |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc(N2C(=O)CC[C@H]2CN2CCCC2)cc1 |
| InChI | InChI=1S/C23H35N3O2/c1-19-6-4-15-25(19)16-5-17-28-22-10-7-20(8-11-22)26-21(9-12-23(26)27)18-24-13-2-3-14-24/h7-8,10-11,19,21H,2-6,9,12-18H2,1H3/t19-,21+/m1/s1 |
| InChIKey | QQNTXXQXVZWHSB-CTNGQTDRSA-N |
| XLogP | 3.53 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|